What is the CAS number of Tristearin?
The CAS number of Tristearin is 555-43-1.
What are some synonyms for Tristearin?
Some synonyms for Tristearin are Glycerol tristearate, and Glyceryl tristearate.
What is the IUPAC name of Tristearin?
The IUPAC name of Tristearin is 2,3-Di(octadecanoyloxy)propyl octadecanoate.
What is the molecular weight of Tristearin?
The molecular weight of Tristearin is 891.48.
What is the molecular formula of Tristearin?
The molecular formula of Tristearin is C57H110O6.
What is the melting point of Tristearin?
The melting point of Tristearin is 72-75 °C.
What is the boiling point of Tristearin?
The boiling point of Tristearin is 260 °C.
What is the InChI key of Tristearin?
The InChI key of Tristearin is InChI=1S/C57H110O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h54H,4-53H2,1-3H3.
What is the physical state of Tristearin?
Tristearin is in a solid physical state.
What are the typical applications of Tristearin?
Tristearin is commonly used as a sizing agent in textiles.
PAGE TOP