
What is the CAS number for Tripalmitin?
The CAS number for Tripalmitin is 555-44-2.
What are some synonyms for Tripalmitin?
Some synonyms for Tripalmitin are Glycerol tripalmitate, Hexadecanoic acid, 1,2,3-propanetriyl ester, and Glyceryl tripalmitate.
What is the IUPAC name of Tripalmitin?
The IUPAC name of Tripalmitin is 2,3-Di(hexadecanoyloxy)propyl hexadecanoate.
What is the molecular weight of Tripalmitin?
The molecular weight of Tripalmitin is 807.32.
What is the molecular formula of Tripalmitin?
The molecular formula of Tripalmitin is C51H98O6.
What is the InChI key for Tripalmitin?
The InChI key for Tripalmitin is InChI=1S/C51H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h48H,4-47H2,1-3H3.
What is the boiling point of Tripalmitin?
The boiling point of Tripalmitin is 310-320 °C.
What is the melting point of Tripalmitin?
The melting point of Tripalmitin is 66-68 °C.
What is the density of Tripalmitin?
The density of Tripalmitin is 0.875g/ml.
What are the typical applications of Tripalmitin?
The typical applications of Tripalmitin are use as lubricant, use as dispersing agent, and emulsion stabilizer.