What is the molecular formula of Trioctyl phosphate?
The molecular formula of Trioctyl phosphate is C24H51O4P.
What is the molecular weight of Trioctyl phosphate?
The molecular weight of Trioctyl phosphate is 434.6 g/mol.
What is the IUPAC name of Trioctyl phosphate?
The IUPAC name of Trioctyl phosphate is trioctyl phosphate.
What is the Canonical SMILES representation of Trioctyl phosphate?
The Canonical SMILES representation of Trioctyl phosphate is CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC.
What is the InChIKey of Trioctyl phosphate?
The InChIKey of Trioctyl phosphate is WVPGXJOLGGFBCR-UHFFFAOYSA-N.
What are the synonyms of Trioctyl phosphate?
The synonyms of Trioctyl phosphate include TRIOCTYL PHOSPHATE, Phosphoric acid trioctyl ester, and Tri-N-octyl phosphate.
What is the CAS number of Trioctyl phosphate?
The CAS number of Trioctyl phosphate is 1806-54-8.
What is the molecular complexity of Trioctyl phosphate?
The molecular complexity of Trioctyl phosphate is 311.
How many rotatable bonds are present in Trioctyl phosphate?
There are 24 rotatable bonds present in Trioctyl phosphate.
What is the hydrogen bond acceptor count of Trioctyl phosphate?
The hydrogen bond acceptor count of Trioctyl phosphate is 4.
PAGE TOP