
What is the CAS number for Trimethylolpropane triethylhexanoate?
The CAS number for Trimethylolpropane triethylhexanoate is 26086-33-9.
What is the molecular formula of Trimethylolpropane triethylhexanoate?
The molecular formula of Trimethylolpropane triethylhexanoate is C30H56O6.
What is the molecular weight of Trimethylolpropane triethylhexanoate?
The molecular weight of Trimethylolpropane triethylhexanoate is 512.76.
What are some synonyms for Trimethylolpropane triethylhexanoate?
Some synonyms for Trimethylolpropane triethylhexanoate include Hexanoic acid, 2-ethyl-, triester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol.
What is the IUPAC name of Trimethylolpropane triethylhexanoate?
The IUPAC name of Trimethylolpropane triethylhexanoate is 2,2-Bis(2-ethylhexanoyloxymethyl)butyl 2-ethylhexanoate.
What is the boiling point of Trimethylolpropane triethylhexanoate?
The boiling point of Trimethylolpropane triethylhexanoate is 555.5±30.0 °C.
What is the density of Trimethylolpropane triethylhexanoate?
The density of Trimethylolpropane triethylhexanoate is 0.942g/ml.
What are the typical applications of Trimethylolpropane triethylhexanoate?
Trimethylolpropane triethylhexanoate is used as a lubricant, dispersing agent, and emulsion stabilizer.
What is the percentage of actives in Trimethylolpropane triethylhexanoate?
The percentage of actives in Trimethylolpropane triethylhexanoate is 95%.
Can you provide the SMILES notation of Trimethylolpropane triethylhexanoate?
The SMILES notation of Trimethylolpropane triethylhexanoate is CCCCC(CC)C(=O)OCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC.