What is the IUPAC name of Trimethyl pentaphenyl trisiloxane?
The IUPAC name of Trimethyl pentaphenyl trisiloxane is Methyl-bis[[methyl(diphenyl)silyl]oxy]-phenylsilane.
What is the CAS number of Trimethyl pentaphenyl trisiloxane?
The CAS number of Trimethyl pentaphenyl trisiloxane is 28855-11-0.
What is the molecular weight of Trimethyl pentaphenyl trisiloxane?
The molecular weight of Trimethyl pentaphenyl trisiloxane is 546.88.
What is the molecular formula of Trimethyl pentaphenyl trisiloxane?
The molecular formula of Trimethyl pentaphenyl trisiloxane is C33H34O2Si3.
What is the typical application of Trimethyl pentaphenyl trisiloxane?
The typical application of Trimethyl pentaphenyl trisiloxane is as an emollient.
What is the SMILES notation for Trimethyl pentaphenyl trisiloxane?
The SMILES notation for Trimethyl pentaphenyl trisiloxane is C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)(C3=CC=CC=C3)O[Si](C)(C4=CC=CC=C4)C5=CC=CC=C5.
What is the InChI Key for Trimethyl pentaphenyl trisiloxane?
The InChI Key for Trimethyl pentaphenyl trisiloxane is InChI=1S/C33H34O2Si3/c1-36(29-19-9-4-10-20-29,30-21-11-5-12-22-30)34-38(3,33-27-17-8-18-28-33)35-37(2,31-23-13-6-14-24-31)32-25-15-7-16-26-32/h4-28H,1-3H3.
What is the physical state of Trimethyl pentaphenyl trisiloxane?
The physical state of Trimethyl pentaphenyl trisiloxane is liquid.
What percentage of Trimethyl pentaphenyl trisiloxane is actives?
95% of Trimethyl pentaphenyl trisiloxane is actives.
Can Trimethyl pentaphenyl trisiloxane be used for skincare products?
Yes, Trimethyl pentaphenyl trisiloxane can be used in skincare products as an emollient.
PAGE TOP