
What is the CAS number for Triethylhexyl trimellitate?
The CAS number for Triethylhexyl trimellitate is 3319-31-1.
What are some synonyms for Triethylhexyl trimellitate?
Some synonyms for Triethylhexyl trimellitate are Tri(2-ethylhexyl) trimellitate and Tris(2-ethylhexyl) benzene-1,2,4-tricarboxylate.
What is the IUPAC name of Triethylhexyl trimellitate?
The IUPAC name of Triethylhexyl trimellitate is Tris(2-ethylhexyl) benzene-1,2,4-tricarboxylate.
What is the molecular weight of Triethylhexyl trimellitate?
The molecular weight of Triethylhexyl trimellitate is 546.78.
What is the molecular formula of Triethylhexyl trimellitate?
The molecular formula of Triethylhexyl trimellitate is C33H54O6.
What is the boiling point of Triethylhexyl trimellitate?
The boiling point of Triethylhexyl trimellitate is 414 °C.
What is the density of Triethylhexyl trimellitate?
The density of Triethylhexyl trimellitate is 0.99g/ml.
What are some typical applications of Triethylhexyl trimellitate?
Some typical applications of Triethylhexyl trimellitate are its use as a dispersing agent, emulsion stabilizer, lubricant, and plasticizer.
What is the percentage of actives in Triethylhexyl trimellitate?
The percentage of actives in Triethylhexyl trimellitate is 95%.
What is the InChI key of Triethylhexyl trimellitate?
The InChI key of Triethylhexyl trimellitate is InChI=1S/C33H54O6/c1-7-13-16-25(10-4)22-37-31(34)28-19-20-29(32(35)38-23-26(11-5)17-14-8-2)30(21-28)33(36)39-24-27(12-6)18-15-9-3/h19-21,25-27H,7-18,22-24H2,1-6H3.