What is the product name of the chemical with CAS number 17511-60-3?
The product name is Tricyclodecenyl propionate.
What are the synonyms of Tricyclodecenyl propionate?
The synonyms are 7-Methanoinden-6-ol,3a,4,5,6,7,7a-hexahydro-propionate.
What is the IUPAC name of Tricyclodecenyl propionate?
The IUPAC name is 8-Tricyclo[5.2.1.0²,⁶]dec-3-enyl propanoate.
What is the molecular weight of Tricyclodecenyl propionate?
The molecular weight of Tricyclodecenyl propionate is 206.28.
What is the molecular formula of Tricyclodecenyl propionate?
The molecular formula is C13H18O2.
What is the InChI of Tricyclodecenyl propionate?
The InChI is InChI=1S/C13H18O2/c1-2-13(14)15-12-7-8-6-11(12)10-5-3-4-9(8)10/h3-4,8-12H,2,5-7H2,1H3.
What is the boiling point of Tricyclodecenyl propionate?
The boiling point is 305.14 °C.
What is the purity of Tricyclodecenyl propionate?
The purity is 95%+.
What is the density of Tricyclodecenyl propionate at 25 °C?
The density is 1.0176 g/mL at 25 °C.
What are the typical applications of Tricyclodecenyl propionate?
It is used as a perfume.
PAGE TOP