What is the IUPAC name of Tetrahydroxypropyl ethylenediamine?
The IUPAC Name is 1-[2-[Bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol.
What is the molecular weight of Tetrahydroxypropyl ethylenediamine?
The molecular weight is 292.41.
What is the molecular formula of Tetrahydroxypropyl ethylenediamine?
The molecular formula is C14H32N2O4.
What is the boiling point of Tetrahydroxypropyl ethylenediamine?
The boiling point is 175-181 °C at 0.8mmHg.
What is the melting point of Tetrahydroxypropyl ethylenediamine?
The melting point is 32 °C.
What is the density of Tetrahydroxypropyl ethylenediamine?
The density is 1.03 g/ml.
What are some typical applications of Tetrahydroxypropyl ethylenediamine?
Some typical applications are use as a solvent, cleansing agent, emulsifying agent, and dispersing agent.
What is the pH of Tetrahydroxypropyl ethylenediamine at 10g/l in water at 20 °C?
The pH is 10.4.
What is the InChI Key of Tetrahydroxypropyl ethylenediamine?
The InChI Key is InChI=1S/C14H32N2O4/c1-11(17)7-15(8-12(2)18)5-6-16(9-13(3)19)10-14(4)20/h11-14,17-20H,5-10H2,1-4H3.
What is the percentage of actives in Tetrahydroxypropyl ethylenediamine?
The percentage of actives is 95%.