What is the IUPAC name of Tetrahydroxyethyl ethylenediamine?
The IUPAC name of Tetrahydroxyethyl ethylenediamine is 2-[2-[Bis(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]ethanol.
What is the molecular weight of Tetrahydroxyethyl ethylenediamine?
The molecular weight of Tetrahydroxyethyl ethylenediamine is 236.31.
What is the molecular formula of Tetrahydroxyethyl ethylenediamine?
The molecular formula of Tetrahydroxyethyl ethylenediamine is C10H24N2O4.
What is the SMILES representation of Tetrahydroxyethyl ethylenediamine?
The SMILES representation of Tetrahydroxyethyl ethylenediamine is C(CN(CCO)CCO)N(CCO)CCO.
What is the InChI Key of Tetrahydroxyethyl ethylenediamine?
The InChI Key of Tetrahydroxyethyl ethylenediamine is InChI=1S/C10H24N2O4/c13-7-3-11(4-8-14)1-2-12(5-9-15)6-10-16/h13-16H,1-10H2.
What is the melting point of Tetrahydroxyethyl ethylenediamine?
The melting point of Tetrahydroxyethyl ethylenediamine is 280 °C.
What is the flash point of Tetrahydroxyethyl ethylenediamine?
The flash point of Tetrahydroxyethyl ethylenediamine is 110°C.
What is the density of Tetrahydroxyethyl ethylenediamine?
The density of Tetrahydroxyethyl ethylenediamine is 1.1g/ml.
What is the percentage of actives in Tetrahydroxyethyl ethylenediamine?
The percentage of actives in Tetrahydroxyethyl ethylenediamine is 95%.
What are some typical applications of Tetrahydroxyethyl ethylenediamine?
Some typical applications of Tetrahydroxyethyl ethylenediamine include its use as a solvent, cleansing agent, emulsifying agent, and dispersing agent.
PAGE TOP