What is the CAS number for Tetrahydropiperine?
The CAS number for Tetrahydropiperine is 23434-88-0.
What is another synonym for Tetrahydropiperine?
Another synonym for Tetrahydropiperine is Cosmoperine.
What is the molecular weight of Tetrahydropiperine?
The molecular weight of Tetrahydropiperine is 289.4.
What is the molecular formula of Tetrahydropiperine?
The molecular formula of Tetrahydropiperine is C17H23NO3.
What is the InChI for Tetrahydropiperine?
The InChI for Tetrahydropiperine is InChI=1S/C17H23NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h8-9,12H,1-7,10-11,13H2
What is the InChI Key for Tetrahydropiperine?
The InChI Key for Tetrahydropiperine is APZYKUZPJCQGPP-UHFFFAOYSA-N.
What is the purity of Tetrahydropiperine?
The purity of Tetrahydropiperine is 95%+.
What is the percentage of actives in Tetrahydropiperine?
The percentage of actives in Tetrahydropiperine is 95%.
What are the typical applications of Tetrahydropiperine?
Tetrahydropiperine is used as a dispersing agent and emulsifying agent in typical applications.
PAGE TOP