What is the product name of the compound with CAS number 83708-66-1?
The product name is Tetradecanoic acid, isohexadecy ester.
What are some synonyms for Tetradecanoic acid, isohexadecy ester?
One synonym is Isocetyl myristate.
What is the IUPAC name of Tetradecanoic acid, isohexadecy ester?
The IUPAC name is 14-Methylpentadecyl tetradecanoate.
What is the molecular weight of Tetradecanoic acid, isohexadecy ester?
The molecular weight is 452.8.
What is the molecular formula of Tetradecanoic acid, isohexadecy ester?
The molecular formula is C30H60O2.
What is the SMILES notation for Tetradecanoic acid, isohexadecy ester?
The SMILES notation is CCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCC(C)C.
What is the InChI key for Tetradecanoic acid, isohexadecy ester?
The InChI key is InChI=1S/C30H60O2/c1-4-5-6-7-8-9-11-15-18-21-24-27-30(31)32-28-25-22-19-16-13-10-12-14-17-20-23-26-29(2)3/h29H,4-28H2,1-3H3.
What percentage of actives does Tetradecanoic acid, isohexadecy ester contain?
It contains 95% actives.
In what physical state does Tetradecanoic acid, isohexadecy ester exist?
It exists in the liquid state.
What are some typical applications of Tetradecanoic acid, isohexadecy ester?
Some typical applications include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.