What is the IUPAC name of tetradecanoic acid, 2-ethylhexyl ester?
The IUPAC name of tetradecanoic acid, 2-ethylhexyl ester is 2-Ethylhexyl tetradecanoate.
What is the CAS number of tetradecanoic acid, 2-ethylhexyl ester?
The CAS number is 29806-75-5.
What is the molecular weight of tetradecanoic acid, 2-ethylhexyl ester?
The molecular weight is 340.58.
What is the molecular formula of tetradecanoic acid, 2-ethylhexyl ester?
The molecular formula is C22H44O2.
What is the boiling point of tetradecanoic acid, 2-ethylhexyl ester?
The boiling point is 381.5±10.0 °C.
What is the density of tetradecanoic acid, 2-ethylhexyl ester?
The density is 0.861±0.06g/ml.
What are some synonyms for tetradecanoic acid, 2-ethylhexyl ester?
Some synonyms are 2-Ethylhexyl myristate and Ethylhexyl myristate.
What are the typical applications of tetradecanoic acid, 2-ethylhexyl ester?
The typical applications include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
What is the InChI Key of tetradecanoic acid, 2-ethylhexyl ester?
The InChI Key is InChI=1S/C22H44O2/c1-4-7-9-10-11-12-13-14-15-16-17-19-22(23)24-20-21(6-3)18-8-5-2/h21H,4-20H2,1-3H3.
What is the percentage of actives in tetradecanoic acid, 2-ethylhexyl ester?
The percentage of actives is 95%.
PAGE TOP