What is the IUPAC name of terpineol acetate?
The IUPAC name of terpineol acetate is 2-(4-Methylcyclohex-3-en-1-yl)propan-2-yl acetate.
What is the molecular weight of terpineol acetate?
The molecular weight of terpineol acetate is 196.27.
What is the molecular formula of terpineol acetate?
The molecular formula of terpineol acetate is C12H20O2.
What is the SMILES notation for terpineol acetate?
The SMILES notation for terpineol acetate is CC1=CCC(CC1)C(C)(C)OC(=O)C.
What is the boiling point of terpineol acetate?
The boiling point of terpineol acetate is 220 °C.
What is the density of terpineol acetate?
The density of terpineol acetate is 0.953 g/ml.
What are some synonyms for terpineol acetate?
Some synonyms for terpineol acetate are terpinyl acetate.
What are some typical applications of terpineol acetate?
Some typical applications of terpineol acetate include its use as a perfume, solvent, cleansing agent, and paint remover.
What is the percentage of actives in terpineol acetate?
The percentage of actives in terpineol acetate is 95%.
What is the CAS number for terpineol acetate?
The CAS number for terpineol acetate is 8007-35-0.
PAGE TOP