What is the IUPAC name of TAED?
The IUPAC name of TAED is N-acetyl-N-[2-(diacetylamino)ethyl]acetamide.
What is the CAS number of TAED?
The CAS number of TAED is 10543-57-4.
What is the molecular weight of TAED?
The molecular weight of TAED is 228.25.
What is the molecular formula of TAED?
The molecular formula of TAED is C10H16N2O4.
What is the SMILES notation for TAED?
The SMILES notation for TAED is CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C.
What is the InChI Key of TAED?
The InChI Key of TAED is InChI=1S/C10H16N2O4/c1-7(13)11(8(2)14)5-6-12(9(3)15)10(4)16/h5-6H2,1-4H3.
What is the melting point of TAED?
The melting point of TAED is 149-154 °C.
What is the density of TAED?
The density of TAED is 0.9g/ml.
What is the percentage of actives in TAED?
The percentage of actives in TAED is 95%.
What is the typical application of TAED?
The typical application of TAED is as a bleaching activator.
PAGE TOP