
What is the CAS number for Stearyl Palmitate?
The CAS number for Stearyl Palmitate is 2598-99-4.
What are some synonyms for Stearyl Palmitate?
Some synonyms for Stearyl Palmitate are Palmitic Acid Stearyl Ester and Octadecyl hexadecanoate.
What is the molecular weight of Stearyl Palmitate?
The molecular weight of Stearyl Palmitate is 508.90.
What is the molecular formula of Stearyl Palmitate?
The molecular formula of Stearyl Palmitate is C34H68O2.
What is the InChI key for Stearyl Palmitate?
The InChI key for Stearyl Palmitate is InChI=1S/C34H68O2/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-36-34(35)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h3-33H2,1-2H3.
What is the boiling point of Stearyl Palmitate?
The boiling point of Stearyl Palmitate is 528.5±18.0 °C.
What is the melting point of Stearyl Palmitate?
The melting point of Stearyl Palmitate is 59 °C.
What is the purity of Stearyl Palmitate?
The purity of Stearyl Palmitate is 99%+.
What is the density of Stearyl Palmitate?
The density of Stearyl Palmitate is 0.857±0.06g/ml.
What are some typical applications of Stearyl Palmitate?
Some typical applications of Stearyl Palmitate are as a dispersing agent, emulsion stabilizer, lubricant, and brightening agent.