What is the IUPAC name of the compound with the CAS number 35230-14-9?
The IUPAC name is Octadecyl 2-hydroxypropanoate.
What is the molecular weight of Stearyl lactate?
The molecular weight is 342.56.
What is the molecular formula of Stearyl lactate?
The molecular formula is C21H42O3.
What is the boiling point of Stearyl lactate?
The boiling point is 378.5±10.0 °C.
What is the density of Stearyl lactate?
The density is 0.909±0.06g/ml.
What are the synonyms for Stearyl lactate?
The synonyms are 2-Hydroxypropanoic acid, octadecyl ester; Octadecyl lactate.
What are the typical applications of Stearyl lactate?
The typical applications include use as a dispersing agent, emulsion stabilizer, and lubricant.
What is the percentage of actives in Stearyl lactate?
The percentage of actives is 95%.
What is the SMILES notation for Stearyl lactate?
The SMILES notation is CCCCCCCCCCCCCCCCCCOC(=O)C(C)O.
What is the InChI Key for Stearyl lactate?
The InChI Key is InChI=1S/C21H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-21(23)20(2)22/h20,22H,3-19H2,1-2H3.
PAGE TOP