What is the CAS number of Stearoxypropyl dimethylamine?
The CAS number of Stearoxypropyl dimethylamine is 17517-01-0.
What are the synonyms of Stearoxypropyl dimethylamine?
The synonyms of Stearoxypropyl dimethylamine are N,N-Dimethyl-3-(octadecyloxy)propylamine and N,N-dimethyl-3-octadecoxypropan-1-amine.
What is the molecular weight of Stearoxypropyl dimethylamine?
The molecular weight of Stearoxypropyl dimethylamine is 355.64.
What is the molecular formula of Stearoxypropyl dimethylamine?
The molecular formula of Stearoxypropyl dimethylamine is C23H49NO.
What is the SMILES notation for Stearoxypropyl dimethylamine?
The SMILES notation for Stearoxypropyl dimethylamine is CCCCCCCCCCCCCCCCCCOCCCN(C)C.
What is the InChI key for Stearoxypropyl dimethylamine?
The InChI key for Stearoxypropyl dimethylamine is InChI=1S/C23H49NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-25-23-20-21-24(2)3/h4-23H2,1-3H3.
What percentage of actives does Stearoxypropyl dimethylamine contain?
Stearoxypropyl dimethylamine contains 95% actives.
What is the physical state of Stearoxypropyl dimethylamine?
The physical state of Stearoxypropyl dimethylamine is solid.
What are the typical applications of Stearoxypropyl dimethylamine?
The typical application of Stearoxypropyl dimethylamine is hair conditioning.
What role does Stearoxypropyl dimethylamine play in hair care products?
Stearoxypropyl dimethylamine acts as a conditioning agent in hair care products.