What is the IUPAC name of Stearamide MEA-stearate?
The IUPAC name of Stearamide MEA-stearate is 2-(Octadecanoylamino)ethyl octadecanoate.
What is the molecular weight of Stearamide MEA-stearate?
The molecular weight of Stearamide MEA-stearate is 594.01.
What is the molecular formula of Stearamide MEA-stearate?
The molecular formula of Stearamide MEA-stearate is C38H75NO3.
What is the boiling point of Stearamide MEA-stearate?
The boiling point of Stearamide MEA-stearate is 678.5±38.0 °C.
What is the melting point of Stearamide MEA-stearate?
The melting point of Stearamide MEA-stearate is 92-94 °C.
What is the density of Stearamide MEA-stearate?
The density of Stearamide MEA-stearate is 0.892±0.06 g/ml.
What are some typical applications of Stearamide MEA-stearate?
Some typical applications of Stearamide MEA-stearate are as a dispersing agent, emulsion stabilizer, and lubricant.
What is the percentage of actives in Stearamide MEA-stearate?
The percentage of actives in Stearamide MEA-stearate is 95%.
What are some synonyms for Stearamide MEA-stearate?
Some synonyms for Stearamide MEA-stearate are 2-((1-Oxooctadecyl)amino)ethyl stearate and Octadecanoic acid, 2-((1-oxooctadecyl)amino)ethyl ester.
Can you provide the InChI Key for Stearamide MEA-stearate?
The InChI Key for Stearamide MEA-stearate is InChI=1S/C38H75NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(40)39-35-36-42-38(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-36H2,1-2H3,(H,39,40).
PAGE TOP