What is the IUPAC name of Sphinganine?
The IUPAC name of Sphinganine is (2S,3R)-2-aminooctadecane-1,3-diol.
What is the molecular weight of Sphinganine?
The molecular weight of Sphinganine is 301.51.
What is the molecular formula of Sphinganine?
The molecular formula of Sphinganine is C18H39NO2.
What is the boiling point of Sphinganine?
The boiling point of Sphinganine is 446.0±25.0°C.
What is the melting point of Sphinganine?
The melting point of Sphinganine is 70-72°C.
What is the density of Sphinganine?
The density of Sphinganine is 0.927±0.06g/ml.
What are some synonyms of Sphinganine?
Some synonyms of Sphinganine include (R-(R*,S*))-2-Aminooctadecane-1,3-diol and 1,3-Octadecanediol, 2-amino-, (2S,3R)-.
What are the typical applications of Sphinganine?
The typical applications of Sphinganine include use as an emulsifying agent, dispersing agent, lubricant, and intermediate in organic synthesis.
What is the InChI key for Sphinganine?
The InChI key for Sphinganine is InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3/t17-,18+/m0/s1.
What percentage of actives does Sphinganine contain?
Sphinganine contains 95% actives.
PAGE TOP