What is the CAS number for Sorbitan monoisooctadecanoate?
The CAS number for Sorbitan monoisooctadecanoate is 54392-26-6.
What are some synonyms for Sorbitan monoisooctadecanoate?
Some synonyms for Sorbitan monoisooctadecanoate are Sorbitan isostearate.
What is the molecular weight of Sorbitan monoisooctadecanoate?
The molecular weight of Sorbitan monoisooctadecanoate is 430.62.
What is the molecular formula of Sorbitan monoisooctadecanoate?
The molecular formula of Sorbitan monoisooctadecanoate is C24H46O6.
What is the IUPAC name of Sorbitan monoisooctadecanoate?
The IUPAC name of Sorbitan monoisooctadecanoate is [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 16-methylheptadecanoate.
What is the SMILES representation of Sorbitan monoisooctadecanoate?
The SMILES representation of Sorbitan monoisooctadecanoate is CC(C)CCCCCCCCCCCCCCC(=O)O[C@H](CO)[C@@H]1[C@@H]([C@H](CO1)O).
What is the InChI of Sorbitan monoisooctadecanoate?
The InChI of Sorbitan monoisooctadecanoate is FGUZFFWTBWJBIL-XWVZOOPGSA-N.
What is the InChI Key of Sorbitan monoisooctadecanoate?
The InChI Key of Sorbitan monoisooctadecanoate is InChI=1S/C24H46O6/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-22(27)30-21(17-25)24-23(28)20(26)18-29-24/h19-21,23-26,28H,3-18H2,1-2H3/t20-,21+,23+,24+/m0/s1.
What is the percentage of actives in Sorbitan monoisooctadecanoate?
The percentage of actives in Sorbitan monoisooctadecanoate is 95%.
What are some typical applications of Sorbitan monoisooctadecanoate?
Some typical applications of Sorbitan monoisooctadecanoate are its use as a lubricant, dispersing agent, and emulsifying agent.