What is the molecular formula of Solvent Red 41?
The molecular formula of Solvent Red 41 is C20H19N3.
What is the molecular weight of Solvent Red 41?
The molecular weight of Solvent Red 41 is 301.4 g/mol.
What are some synonyms for Solvent Red 41?
Some synonyms for Solvent Red 41 include Fuchsine Base, Rosaniline base, and C.I. Solvent Red 41.
What is the IUPAC name of Solvent Red 41?
The IUPAC name of Solvent Red 41 is 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline.
What is the InChIKey for Solvent Red 41?
The InChIKey for Solvent Red 41 is YDCMWLQSPFTWCS-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Solvent Red 41?
The Canonical SMILES representation of Solvent Red 41 is CC1=CC(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C=CC1=N.
What is the CAS number for Solvent Red 41?
The CAS number for Solvent Red 41 is 3248-93-9.
How many hydrogen bond donor counts does Solvent Red 41 have?
Solvent Red 41 has 3 hydrogen bond donor counts.
What is the topological polar surface area of Solvent Red 41?
The topological polar surface area of Solvent Red 41 is 75.9 Ų.
What is the complexity of Solvent Red 41?
The complexity of Solvent Red 41 is 515.