
What is the product name of CAS number 85-83-6?
The product name is Solvent red 24.
What is the molecular weight of Solvent red 24?
The molecular weight of Solvent red 24 is 380.44.
What is the molecular formula of Solvent red 24?
The molecular formula of Solvent red 24 is C24H20N4O.
What are some synonyms for Solvent red 24?
One synonym for Solvent red 24 is 1-(2-Methyl-4-(2-methylphenylazo)phenylazo)-2-naphthol.
What is the physical state of Solvent red 24?
Solvent red 24 is in a solid physical state.
What is the typical application of Solvent red 24?
The typical application of Solvent red 24 is as a pigment for red color.
What is the boiling point of Solvent red 24?
The boiling point of Solvent red 24 is 260°C.
What is the appearance of Solvent red 24?
Solvent red 24 appears as dark red to brown crystals or powder.
What is the purity of Solvent red 24?
Solvent red 24 is considered 'PURIFIED' in terms of purity.
What is the InChI Key of Solvent red 24?
The InChI Key of Solvent red 24 is InChI=1S/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3.