
What is the molecular formula of Solvent Red 1?
The molecular formula of Solvent Red 1 is C17H14N2O2.
What is the molecular weight of Solvent Red 1?
The molecular weight of Solvent Red 1 is 278.30 g/mol.
What is the IUPAC Name of Solvent Red 1?
The IUPAC Name of Solvent Red 1 is 1-[(2-methoxyphenyl)diazenyl]naphthalen-2-ol.
What is the InChIKey of Solvent Red 1?
The InChIKey of Solvent Red 1 is ALLOLPOYFRLCCX-UHFFFAOYSA-N.
What is the Canonical SMILES of Solvent Red 1?
The Canonical SMILES of Solvent Red 1 is COC1=CC=CC=C1N=NC2=C(C=CC3=CC=CC=C32)O.
What are the other identifiers for Solvent Red 1?
Other identifiers for Solvent Red 1 include CAS number 1229-55-6, EC number 214-968-9, and ChEMBL ID CHEMBL1986529.
What is the XLogP3-AA value of Solvent Red 1?
The XLogP3-AA value of Solvent Red 1 is 4.6.
How many hydrogen bond acceptor counts does Solvent Red 1 have?
Solvent Red 1 has 4 hydrogen bond acceptor counts.
What is the exact mass of Solvent Red 1?
The exact mass of Solvent Red 1 is 278.105527694 g/mol.
How many defined atom stereocenters does Solvent Red 1 have?
Solvent Red 1 has 0 defined atom stereocenters.