IUPAC Name
Sodium;(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate
InChI Key
InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2+,3+,4-,6?;/m0./s1
Application
Sodium alginate, derived from seaweed, serves multiple purposes due to its unique properties as a polymer. It is widely utilized in both the food and pharmaceutical industries. Its primary purpose in the food industry is to increase viscosity and act as an emulsifier, stabilizer, and gelling agent. This makes it invaluable in the production of ice cream, desserts, sauces, and edible films, ensuring a desired texture and preventing ice crystallization. In pharmaceuticals, sodium alginate functions as a binder, disintegrant, and a controlled-release agent in tablets and capsules, and is also used in topical formulations such as creams and gels. Its ability to form hydrogels through cross-linking with calcium ions is exploited in various medical applications, including wound dressings, drug delivery systems, and as a barrier against gastric reflux. The versatility and bioadhesive properties of sodium alginate allow for innovative uses in oral, nasal, ophthalmic, and mucoadhesive delivery systems, further supporting therapeutic interventions. Additionally, it finds applications in dental impressions, cosmetics, and even in environmental treatments such as water purification.