What is the molecular formula of Sodium 2-ethylhexanoate?
The molecular formula of Sodium 2-ethylhexanoate is C8H15NaO2.
What is the molecular weight of Sodium 2-ethylhexanoate?
The molecular weight of Sodium 2-ethylhexanoate is 166.19 g/mol.
What are the synonyms of Sodium 2-ethylhexanoate?
Some synonyms of Sodium 2-ethylhexanoate include Hexanoic acid, 2-ethyl-, sodium salt and 2-Ethylhexanoic acid sodium salt.
What is the IUPAC name of Sodium 2-ethylhexanoate?
The IUPAC name of Sodium 2-ethylhexanoate is sodium;2-ethylhexanoate.
What is the Canonical SMILES of Sodium 2-ethylhexanoate?
The Canonical SMILES of Sodium 2-ethylhexanoate is CCCCC(CC)C(=O)[O-].[Na+].
What is the InChIKey of Sodium 2-ethylhexanoate?
The InChIKey of Sodium 2-ethylhexanoate is VYPDUQYOLCLEGS-UHFFFAOYSA-M.
What is the CAS number of Sodium 2-ethylhexanoate?
The CAS number of Sodium 2-ethylhexanoate is 19766-89-3.
What is the hydrogen bond acceptor count of Sodium 2-ethylhexanoate?
The hydrogen bond acceptor count of Sodium 2-ethylhexanoate is 2.
What is the exact mass of Sodium 2-ethylhexanoate?
The exact mass of Sodium 2-ethylhexanoate is 166.09697400 g/mol.
How many rotatable bond counts does Sodium 2-ethylhexanoate have?
Sodium 2-ethylhexanoate has 5 rotatable bond counts.