
What is the PubChem CID of Rutin?
PubChem CID of Rutin is 5280805.
What is the molecular formula of Rutin?
The molecular formula of Rutin is C27H30O16.
What is the molecular weight of Rutin?
The molecular weight of Rutin is 610.5 g/mol.
What is the IUPAC Name of Rutin?
The IUPAC Name of Rutin is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one.
What is the InChI of Rutin?
The InChI of Rutin is InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(40-8)39-7-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-13(31)5-10(28)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1.
What is the CAS number of Rutin?
The CAS number of Rutin is 153-18-4.
What is the ChEBI ID of Rutin?
The ChEBI ID of Rutin is CHEBI:50518.
What is the UNII of Rutin?
The UNII of Rutin is 5G06TVY3R7.
What is the KEGG ID of Rutin?
The KEGG ID of Rutin is C05625.
What is the Lipid Maps ID of Rutin?
The Lipid Maps ID of Rutin is LMPK12112098.