What is the IUPAC name of Ricinus Communis Seed Oil?
The IUPAC name of Ricinus Communis Seed Oil is 2,3-Bis[[(Z)-12-hydroxyoctadec-9-enoyl]oxy]propyl (Z)-12-hydroxyoctadec-9-enoate.
What is the molecular weight of Ricinus Communis Seed Oil?
The molecular weight of Ricinus Communis Seed Oil is 933.43.
What is the molecular formula of Ricinus Communis Seed Oil?
The molecular formula of Ricinus Communis Seed Oil is C57H104O9.
What is the SMILES representation of Ricinus Communis Seed Oil?
The SMILES representation of Ricinus Communis Seed Oil is CCCCCCC(O)C/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CC(O)CCCCCC)COC(=O)CCCCCCC/C=C\CC(O)CCCCCC.
What is the InChI of Ricinus Communis Seed Oil?
The InChI of Ricinus Communis Seed Oil is ZEMPKEQAKRGZGQ-AAKVHIHISA-N.
What is the boiling point of Ricinus Communis Seed Oil?
The boiling point of Ricinus Communis Seed Oil is 313 °C (lit.).
What is the melting point of Ricinus Communis Seed Oil?
The melting point of Ricinus Communis Seed Oil is -10 °C.
What is the density of Ricinus Communis Seed Oil?
The density of Ricinus Communis Seed Oil is 0.955g/ml.
What percentage of actives does Ricinus Communis Seed Oil contain?
Ricinus Communis Seed Oil contains 95% actives.
What are some typical applications of Ricinus Communis Seed Oil?
Some typical applications of Ricinus Communis Seed Oil include its use as a lubricant, dispersing agent, emulsion stabilizer, and lubricating oil.