What is the chemical formula of the product Raffinose?
The chemical formula of Raffinose is C18H32O16.
What are some synonyms for Raffinose?
Some synonyms for Raffinose are Melitose.
What is the molecular weight of Raffinose?
The molecular weight of Raffinose is 504.44.
What is the boiling point of Raffinose?
The boiling point of Raffinose is 514 °C.
What is the melting point of Raffinose?
The melting point of Raffinose is 81 °C.
What is the purity of Raffinose?
The purity of Raffinose is 98%.
What is the density of Raffinose?
The density of Raffinose is 1.81g/ml.
What are the typical applications of Raffinose?
The typical applications of Raffinose include use as an emulsion stabilizer and dispersing agent.
What is the InChI Key for Raffinose?
The InChI Key for Raffinose is InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1.
What is the physical state of Raffinose?
The physical state of Raffinose is a solid.