What is the CAS number for Pyridoxine tripalmitate?
The CAS number for Pyridoxine tripalmitate is 4372-46-7.
What is the molecular weight of Pyridoxine tripalmitate?
The molecular weight of Pyridoxine tripalmitate is 884.4.
What is the molecular formula of Pyridoxine tripalmitate?
The molecular formula of Pyridoxine tripalmitate is C56H101NO6.
What are some synonyms for Pyridoxine tripalmitate?
Some synonyms for Pyridoxine tripalmitate are Hexadecanoic acid, (6-methyl-5-((1-oxohexadecyl)oxy)-3,4-pyridinediyl)bis(methylene) ester.
What is the InChI key for Pyridoxine tripalmitate?
The InChI key for Pyridoxine tripalmitate is InChI=1S/C56H101NO6/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-53(58)61-48-51-47-57-50(4)56(63-55(60)46-43-40-37-34-31-28-25-22-19-16-13-10-7-3)52(51)49-62-54(59)45-42-39-36-33-30-27-24-21-18-15-12-9-6-2/h47H,5-46,48-49H2,1-4H3
What is the boiling point of Pyridoxine tripalmitate?
The boiling point of Pyridoxine tripalmitate is 826.0±65.0 °C.
What is the melting point of Pyridoxine tripalmitate?
The melting point of Pyridoxine tripalmitate is 72-73 °C.
What is the density of Pyridoxine tripalmitate?
The density of Pyridoxine tripalmitate is 0.945±0.06g/ml.
What percentage of Pyridoxine tripalmitate is active?
Pyridoxine tripalmitate is 95% active.
What are some typical applications of Pyridoxine tripalmitate?
Some typical applications of Pyridoxine tripalmitate are its use as an antistatic agent, dispersing agent, and emulsion stabilizer.