What is the CAS number for Pyridoxine HCl?
The CAS number for Pyridoxine HCl is 58-56-0.
What are some synonyms for Pyridoxine HCl?
Some synonyms for Pyridoxine HCl are Pyridoxine hydrochloride.
What is the molecular weight of Pyridoxine HCl?
The molecular weight of Pyridoxine HCl is 205.64.
What is the molecular formula of Pyridoxine HCl?
The molecular formula of Pyridoxine HCl is C8H12ClNO3.
What is the IUPAC name of Pyridoxine HCl?
The IUPAC name of Pyridoxine HCl is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride.
What is the melting point of Pyridoxine HCl?
The melting point of Pyridoxine HCl is 214-215 °C.
What is the density of Pyridoxine HCl?
The density of Pyridoxine HCl is 1.28g/ml.
What are some typical applications of Pyridoxine HCl?
Some typical applications of Pyridoxine HCl are antistatic and skin and hair conditioning.
What is the percentage of actives in Pyridoxine HCl?
The percentage of actives in Pyridoxine HCl is 95%.
What is the InChI Key of Pyridoxine HCl?
The InChI Key of Pyridoxine HCl is InChI=1S/C8H11NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H.