What is the molecular formula of Pyridoxine dicaprylate?
The molecular formula of Pyridoxine dicaprylate is C24H39NO5.
What is the CAS number of Pyridoxine dicaprylate?
The CAS number of Pyridoxine dicaprylate is 106483-04-9.
What is the IUPAC name of Pyridoxine dicaprylate?
The IUPAC name of Pyridoxine dicaprylate is [5-Hydroxy-6-methyl-4-(octanoyloxymethyl)pyridin-3-yl]methyl octanoate.
What is the melting point of Pyridoxine dicaprylate?
The melting point of Pyridoxine dicaprylate is 72 °C.
What are some synonyms of Pyridoxine dicaprylate?
Some synonyms of Pyridoxine dicaprylate are Octanoic acid, diester with 5-hydroxy-6-methyl-3,4-pyridinedimethanol and Pyridoxine dioctanoate.
What is the molecular weight of Pyridoxine dicaprylate?
The molecular weight of Pyridoxine dicaprylate is 421.57.
What is the InChI Key of Pyridoxine dicaprylate?
The InChI Key of Pyridoxine dicaprylate is InChI=1S/C24H39NO5/c1-4-6-8-10-12-14-22(26)29-17-20-16-25-19(3)24(28)21(20)18-30-23(27)15-13-11-9-7-5-2/h16,28H,4-15,17-18H2,1-3H3.
What is the physical state of Pyridoxine dicaprylate?
The physical state of Pyridoxine dicaprylate is solid.
What are the typical applications of Pyridoxine dicaprylate?
The typical applications of Pyridoxine dicaprylate include its use as an antistatic agent, as a dispersing agent, and as an emulsion stabilizer.
What is the percentage of actives in Pyridoxine dicaprylate?
The percentage of actives in Pyridoxine dicaprylate is 95%.
PAGE TOP