
What is the product name of CAS number 135326-54-4?
The product name is Propylene glycol myristyl ether acetate.
What is the IUPAC name of Propylene glycol myristyl ether acetate?
The IUPAC name is 1-Tetradecoxypropan-2-yl acetate.
What is the molecular weight of Propylene glycol myristyl ether acetate?
The molecular weight is 314.5.
What is the molecular formula of Propylene glycol myristyl ether acetate?
The molecular formula is C19H38O3.
What is the SMILES notation for Propylene glycol myristyl ether acetate?
The SMILES notation is CCCCCCCCCCCCCCOCC(C)OC(=O)C.
What is the InChI of Propylene glycol myristyl ether acetate?
The InChI is InChI=1S/C19H38O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-21-17-18(2)22-19(3)20/h18H,4-17H2,1-3H3.
What is the percentage of actives in Propylene glycol myristyl ether acetate?
The percentage of actives is 95%.
In what physical state is Propylene glycol myristyl ether acetate?
It is in liquid physical state.
What are the typical applications of Propylene glycol myristyl ether acetate?
It is commonly used as an emollient.
Can you provide a synonym for Propylene glycol myristyl ether acetate?
One synonym for it is 1-Propanol, 2-(tetradecyloxy)-, acetate.