
What is the CAS number for Propylene glycol dipelargonate?
The CAS number for Propylene glycol dipelargonate is 41395-83-9.
What are some synonyms for Propylene glycol dipelargonate?
Some synonyms for Propylene glycol dipelargonate are Propylene dinonanoate, Propylene glycol dinonanoate, and Nonanoic acid.
What is the molecular weight of Propylene glycol dipelargonate?
The molecular weight of Propylene glycol dipelargonate is 356.54.
What is the molecular formula of Propylene glycol dipelargonate?
The molecular formula of Propylene glycol dipelargonate is C21H40O4.
What is the InChI Key for Propylene glycol dipelargonate?
The InChI Key for Propylene glycol dipelargonate is InChI=1S/C21H40O4/c1-4-6-8-10-12-14-16-20(22)24-18-19(3)25-21(23)17-15-13-11-9-7-5-2/h19H,4-18H2,1-3H3.
What is the boiling point of Propylene glycol dipelargonate?
The boiling point of Propylene glycol dipelargonate is 426.0±18.0 °C.
What is the purity of Propylene glycol dipelargonate?
The purity of Propylene glycol dipelargonate is 96%.
What is the density of Propylene glycol dipelargonate?
The density of Propylene glycol dipelargonate is 0.873g/ml.
What are some typical applications of Propylene glycol dipelargonate?
Some typical applications of Propylene glycol dipelargonate are as a lubricant, dispersing agent, and emulsion stabilizer.
What is the physical state of Propylene glycol dipelargonate?
The physical state of Propylene glycol dipelargonate is liquid.