What is the CAS number of Propylene glycol diethylhexanoate?
The CAS number of Propylene glycol diethylhexanoate is 93981-97-6.
What are some synonyms of Propylene glycol diethylhexanoate?
Some synonyms of Propylene glycol diethylhexanoate are 1-Methylethylene 2-ethylhexanoate and IUPAC Name 2-(2-Ethylhexanoyloxy)propyl 2-ethylhexanoate.
What is the molecular weight of Propylene glycol diethylhexanoate?
The molecular weight of Propylene glycol diethylhexanoate is 328.49.
What is the molecular formula of Propylene glycol diethylhexanoate?
The molecular formula of Propylene glycol diethylhexanoate is C19H36O4.
What is the SMILES representation of Propylene glycol diethylhexanoate?
The SMILES representation of Propylene glycol diethylhexanoate is CCCCC(CC)C(=O)OCC(C)OC(=O)C(CC)CCCC.
What is the InChI of Propylene glycol diethylhexanoate?
The InChI of Propylene glycol diethylhexanoate is RYKSMKFLIHUEBL-UHFFFAOYSA-N.
What is the active percentage of Propylene glycol diethylhexanoate?
The active percentage of Propylene glycol diethylhexanoate is 95%.
What is the physical state of Propylene glycol diethylhexanoate?
Propylene glycol diethylhexanoate is in liquid form.
What are some typical applications of Propylene glycol diethylhexanoate?
Some typical applications of Propylene glycol diethylhexanoate are skin conditioning and emollient.
What are some key identifiers of Propylene glycol diethylhexanoate?
Some key identifiers of Propylene glycol diethylhexanoate are its molecular weight, molecular formula, SMILES representation, and InChI.