
What is the IUPAC name of Propylene glycol didecanoate?
The IUPAC name of Propylene glycol didecanoate is 2-Decanoyloxypropyl decanoate.
What is the molecular weight of Propylene glycol didecanoate?
The molecular weight of Propylene glycol didecanoate is 384.59.
What is the molecular formula of Propylene glycol didecanoate?
The molecular formula of Propylene glycol didecanoate is C23H44O4.
What is the SMILES notation for Propylene glycol didecanoate?
The SMILES notation for Propylene glycol didecanoate is CCCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCCC.
What is the InChI Key for Propylene glycol didecanoate?
The InChI Key for Propylene glycol didecanoate is InChI=1S/C23H44O4/c1-4-6-8-10-12-14-16-18-22(24)26-20-21(3)27-23(25)19-17-15-13-11-9-7-5-2/h21H,4-20H2,1-3H3.
What is the boiling point of Propylene glycol didecanoate?
The boiling point of Propylene glycol didecanoate is 453.5±18.0 °C.
What is the density of Propylene glycol didecanoate?
The density of Propylene glycol didecanoate is 0.925±0.06g/ml.
What is the percentage of actives in Propylene glycol didecanoate?
The percentage of actives in Propylene glycol didecanoate is 95%.
What is the physical state of Propylene glycol didecanoate?
The physical state of Propylene glycol didecanoate is liquid.
What are the typical applications of Propylene glycol didecanoate?
The typical applications of Propylene glycol didecanoate include use as a lubricant, dispersing agent, and emulsion stabilizer.