What is the CAS number for Propylene glycol dicaprylate/dicaprate?
The CAS number for Propylene glycol dicaprylate/dicaprate is 68583-51-7.
What are some synonyms for Propylene glycol dicaprylate/dicaprate?
Some synonyms for Propylene glycol dicaprylate/dicaprate are Decanoic acid, mixed diesters with octanoic acid and propylene glycol and Fatty acids, C8-10, propylene esters.
Can you provide the IUPAC Name for Propylene glycol dicaprylate/dicaprate?
The IUPAC Name for Propylene glycol dicaprylate/dicaprate is Decanoic acid; octanoic acid; propane-1,2-diol.
What is the molecular weight range for Propylene glycol dicaprylate/dicaprate?
The molecular weight range for Propylene glycol dicaprylate/dicaprate is 328.49-384.59.
What is the molecular formula for Propylene glycol dicaprylate/dicaprate?
The molecular formula for Propylene glycol dicaprylate/dicaprate is C19H36O4-C23H44O4.
Can you provide the SMILES notation for Propylene glycol dicaprylate/dicaprate?
The SMILES notation for Propylene glycol dicaprylate/dicaprate is CCCCCCCCCC(=O)O.CCCCCCCC(=O)O.CC(CO)O.
What is the InChI key for Propylene glycol dicaprylate/dicaprate?
The InChI key for Propylene glycol dicaprylate/dicaprate is InChI=1S/C10H20O2.C8H16O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-3(5)2-4/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);3-5H,2H2,1H3.
What is the percentage of actives present in Propylene glycol dicaprylate/dicaprate?
The percentage of actives present in Propylene glycol dicaprylate/dicaprate is 95%.
In what physical state is Propylene glycol dicaprylate/dicaprate typically found?
Propylene glycol dicaprylate/dicaprate is typically found in a liquid physical state.
What are some typical applications of Propylene glycol dicaprylate/dicaprate?
Propylene glycol dicaprylate/dicaprate can be used as a lubricant, as a dispersing agent, and as an emulsion stabilizer.
PAGE TOP