We use cookies to understand how you use our site and to improve the overall user experience. This includes personalizing content and advertising. Read our Privacy Policy
What is the IUPAC name for Propanol, (2-methoxymethylethoxy)-, acetate?
The IUPAC name for Propanol, (2-methoxymethylethoxy)-, acetate is 1-(1-Methoxypropan-2-yloxy)propan-2-yl acetate.
What is the molecular formula of Propanol, (2-methoxymethylethoxy)-, acetate?
The molecular formula of Propanol, (2-methoxymethylethoxy)-, acetate is C9H18O4.
What is the Synonyms used for Propanol, (2-methoxymethylethoxy)-, acetate?
The synonyms used are Dipropylene glycol monomethyl ether acetate and PPG-2 Methyl Ether Acetate.
What is the boiling point of Propanol, (2-methoxymethylethoxy)-, acetate?
The boiling point is 200 °C.
What is the density of Propanol, (2-methoxymethylethoxy)-, acetate?
The density is 0.97g/ml.
What is the molecular weight of Propanol, (2-methoxymethylethoxy)-, acetate?
The molecular weight is 190.24.
What is the InChI Key for Propanol, (2-methoxymethylethoxy)-, acetate?
The InChI Key is InChI=1S/C9H18O4/c1-7(5-11-4)12-6-8(2)13-9(3)10/h7-8H,5-6H2,1-4H3.
What are some typical applications of Propanol, (2-methoxymethylethoxy)-, acetate?
Some typical applications include use as a solvent, solubilizing agent, and cleansing agent.
What is the physical state of Propanol, (2-methoxymethylethoxy)-, acetate?
The physical state is liquid.
What is the percentage of actives in Propanol, (2-methoxymethylethoxy)-, acetate?
The percentage of actives is 95%.
PAGE TOP