What is the IUPAC name for Propanol, (2-methoxymethylethoxy)-, acetate?
The IUPAC name for Propanol, (2-methoxymethylethoxy)-, acetate is 1-(1-Methoxypropan-2-yloxy)propan-2-yl acetate.
What is the molecular formula of Propanol, (2-methoxymethylethoxy)-, acetate?
The molecular formula of Propanol, (2-methoxymethylethoxy)-, acetate is C9H18O4.
What is the Synonyms used for Propanol, (2-methoxymethylethoxy)-, acetate?
The synonyms used are Dipropylene glycol monomethyl ether acetate and PPG-2 Methyl Ether Acetate.
What is the boiling point of Propanol, (2-methoxymethylethoxy)-, acetate?
The boiling point is 200 °C.
What is the density of Propanol, (2-methoxymethylethoxy)-, acetate?
The density is 0.97g/ml.
What is the molecular weight of Propanol, (2-methoxymethylethoxy)-, acetate?
The molecular weight is 190.24.
What is the InChI Key for Propanol, (2-methoxymethylethoxy)-, acetate?
The InChI Key is InChI=1S/C9H18O4/c1-7(5-11-4)12-6-8(2)13-9(3)10/h7-8H,5-6H2,1-4H3.
What are some typical applications of Propanol, (2-methoxymethylethoxy)-, acetate?
Some typical applications include use as a solvent, solubilizing agent, and cleansing agent.
What is the physical state of Propanol, (2-methoxymethylethoxy)-, acetate?
The physical state is liquid.
What is the percentage of actives in Propanol, (2-methoxymethylethoxy)-, acetate?
The percentage of actives is 95%.
PAGE TOP