What is the molecular formula of Potassium hydrogen dl-aspartate?
The molecular formula of Potassium hydrogen dl-aspartate is C4H6KNO4.
When was Potassium hydrogen dl-aspartate created and last modified?
Potassium hydrogen dl-aspartate was created on February 5, 2008, and last modified on December 30, 2023.
What is the molecular weight of Potassium hydrogen dl-aspartate?
The molecular weight of Potassium hydrogen dl-aspartate is 171.19 g/mol.
What are the synonyms for Potassium hydrogen dl-aspartate?
The synonyms for Potassium hydrogen dl-aspartate include potassium hydrogen DL-aspartate, potassium 3-amino-3-carboxypropanoate, and potassium;3-amino-4-hydroxy-4-oxobutanoate.
What is the IUPAC name of Potassium hydrogen dl-aspartate?
The IUPAC name of Potassium hydrogen dl-aspartate is potassium;3-amino-4-hydroxy-4-oxobutanoate.
What is the Canonical SMILES of Potassium hydrogen dl-aspartate?
The Canonical SMILES of Potassium hydrogen dl-aspartate is C(C(C(=O)O)N)C(=O)[O-].[K+].
What is the InChIKey of Potassium hydrogen dl-aspartate?
The InChIKey of Potassium hydrogen dl-aspartate is TXXVQZSTAVIHFD-UHFFFAOYSA-M.
How many hydrogen bond donor counts does Potassium hydrogen dl-aspartate have?
Potassium hydrogen dl-aspartate has 2 hydrogen bond donor counts.
What is the topological polar surface area of Potassium hydrogen dl-aspartate?
The topological polar surface area of Potassium hydrogen dl-aspartate is 103 Å2.
Is the compound Is Canonicalized for Potassium hydrogen dl-aspartate?
Yes, the compound is Canonicalized for Potassium hydrogen dl-aspartate.