What is the CAS number for Polytrimethylene terephthalate resins?
The CAS number for Polytrimethylene terephthalate resins is 26590-75-0.
What are some synonyms for Polytrimethylene terephthalate resins?
Some synonyms for Polytrimethylene terephthalate resins include 1,4-Benzenedicarboxylic acid polymer with 1,3-propandiol.
What is the molecular formula for Polytrimethylene terephthalate resins?
The molecular formula for Polytrimethylene terephthalate resins is (C8H6O4.C3H8O2)x.
What is the melting point of Polytrimethylene terephthalate resins?
The melting point of Polytrimethylene terephthalate resins is 230 °C.
What is the density of Polytrimethylene terephthalate resins?
The density of Polytrimethylene terephthalate resins is 1.33g/ml.
What are the typical applications of Polytrimethylene terephthalate resins?
The typical applications of Polytrimethylene terephthalate resins include binding agent, humectant, and solvent.
What percentage of actives does Polytrimethylene terephthalate resins contain?
Polytrimethylene terephthalate resins contain 95% actives.
What is the physical state of Polytrimethylene terephthalate resins?
The physical state of Polytrimethylene terephthalate resins is solid.
What are the SMILES representations for Polytrimethylene terephthalate resins?
The SMILES representations for Polytrimethylene terephthalate resins are C1=CC(=CC=C1C(=O)O)C(=O)O.C(CO)CO.
Can you provide the InChI Key for Polytrimethylene terephthalate resins?
The InChI Key for Polytrimethylene terephthalate resins is InChI=1S/C8H6O4.C3H8O2/c9-7(10)5-1-2-6(4-3-5)8(11)12;4-5H,1-3H2.
PAGE TOP