What is the chemical name of the product Polypropylene glycol 1-oxopropyl tetradecyl ether?
The chemical name is 3-Tetradecoxypropyl propanoate.
What is the CAS number of Polypropylene glycol 1-oxopropyl tetradecyl ether?
The CAS number is 74775-06-7.
What are some synonyms for Polypropylene glycol 1-oxopropyl tetradecyl ether?
Some synonyms include Poly(oxy(methyl-1,2-ethanediyl)), alpha-(1-oxopropyl)-omega-(tetradecyloxy)-.
What is the molecular weight of Polypropylene glycol 1-oxopropyl tetradecyl ether?
The molecular weight is 386.61.
What is the molecular formula of Polypropylene glycol 1-oxopropyl tetradecyl ether?
The molecular formula is C20H40O3.
What is the SMILES representation of Polypropylene glycol 1-oxopropyl tetradecyl ether?
The SMILES representation is CCCCCCCCCCCCCCOCCCOC(=O)CC.
What is the InChI representation of Polypropylene glycol 1-oxopropyl tetradecyl ether?
The InChI representation is InChI=1S/C20H40O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-22-18-16-19-23-20(21)4-2/h3-19H2,1-2H3.
What is the percentage of actives in Polypropylene glycol 1-oxopropyl tetradecyl ether?
The percentage of actives is 95%.
What is the physical state of Polypropylene glycol 1-oxopropyl tetradecyl ether?
The physical state is liquid.
What are some typical applications of Polypropylene glycol 1-oxopropyl tetradecyl ether?
Some typical applications include skin conditioning and emollient.