Wang, Wen-Yi, et al. Polymers. 2021;13(13):2122.
Antibacterial mechanism of PHMB
Polyhexamethylene biguanide hydrochloride (PHMB) is composed of repeating biguanide units separated by hydrophobic hexamethylene hydrocarbon chains. The antibacterial mechanism of PHMB is highly dependent on the cationic biguanide group that can interact with the negatively charged phosphate headgroups on the bacterial cell membrane, ultimately leading to cell death.
PHMB coating treatment
Add 10% (w/v) PHMB, 5% (w/v) PEG400 and 8% (w/v) binder to deionized water. The fabric samples were processed using the pad-drying method. First fill the fabric sample with a finishing solution with a wet dye pick-up rate of 80%. The samples were then dried in an oven at 90°C for 5 min and then cured at a temperature of 130°C for 45 s.
Antibacterial effect
The anti-virus analysis results showed that the eradication rate of the PHMB treated polyurethane fabric against coronavirus could reach 99% within 2 hours, suggesting that the PHMB treated polyurethane fabric could be used to develop anti coronavirus clothing to curb the spread of COVID-19 in high-risk places.
What is the chemical name of the product Polyhexamethylene biguanide HCl?
The chemical name of Polyhexamethylene biguanide HCl is N'-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide.
What is the CAS number of Polyhexamethylene biguanide HCl?
The CAS number of Polyhexamethylene biguanide HCl is 32289-58-0.
What are the synonyms for Polyhexamethylene biguanide HCl?
The synonyms for Polyhexamethylene biguanide HCl are polyaminopropyl biguanide HCl.
What is the InChI Key for Polyhexamethylene biguanide HCl?
The InChI Key for Polyhexamethylene biguanide HCl is InChI=1S/C10H23N5/c1-9(11)14-7-5-3-4-6-8-15-10(12)13-2/h3-8H2,1-2H3,(H2,11,14)(H3,12,13,15).
What is the physical state of Polyhexamethylene biguanide HCl?
The physical state of Polyhexamethylene biguanide HCl is solid.
What are the typical applications of Polyhexamethylene biguanide HCl?
The typical applications of Polyhexamethylene biguanide HCl include being used as an antimicrobial agent and preservative.
What is the percentage of actives in Polyhexamethylene biguanide HCl?
The percentage of actives in Polyhexamethylene biguanide HCl is 0.95.
What is the molecular formula of Polyhexamethylene biguanide HCl?
The molecular formula of Polyhexamethylene biguanide HCl is C10H23N5.
How is Polyhexamethylene biguanide HCl typically used in antimicrobial applications?
Polyhexamethylene biguanide HCl is commonly used as a biocide in various antimicrobial applications due to its effectiveness against a wide range of microorganisms.
What is the chemical structure of Polyhexamethylene biguanide HCl?
The chemical structure of Polyhexamethylene biguanide HCl consists of a repeating unit of hexamethylene linked by biguanide functional groups.
PAGE TOP