What is the CAS number for Polyglyceryl oleate?
The CAS number for Polyglyceryl oleate is 9007-48-1.
What are some synonyms for Polyglyceryl oleate?
Some synonyms for Polyglyceryl oleate are 1,2,3-Propanetriol, homopolymer, (9Z)-9-octadecenoate and 1,2,3-Propanetriol, homopolymer, (Z)-9-octadecenoate, among others.
What is the IUPAC name of Polyglyceryl oleate?
The IUPAC name of Polyglyceryl oleate is 2,3-Dihydroxypropyl (E)-2,3,4,5-tetrakis(2,3-dihydroxypropyl)-20,21-dihydroxyhenicos-9-enoate.
What is the SMILES representation of Polyglyceryl oleate?
The SMILES representation of Polyglyceryl oleate is C(CCCC/C=C/CCCC(CC(CO)O)C(CC(CO)O)C(CC(CO)O)C(CC(CO)O)C(=O)OCC(CO)O)CCCCC(CO)O.
What is the percentage of actives in Polyglyceryl oleate?
The percentage of actives in Polyglyceryl oleate is 95%.
In what physical state is Polyglyceryl oleate found?
Polyglyceryl oleate is found in a liquid physical state.
What are the typical applications of Polyglyceryl oleate?
The typical applications of Polyglyceryl oleate include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
What is the InChI of Polyglyceryl oleate?
The InChI of Polyglyceryl oleate is InChI=1S/C36H70O14/c37-19-27(43)14-12-10-8-6-4-2-1-3-5-7-9-11-13-26(15-28(44)20-38)33(16-29(45)21-39)34.
What specific property does Polyglyceryl oleate have that makes it suitable for use as an emulsifying agent?
Polyglyceryl oleate has a high percentage of actives (95%), making it suitable for use as an emulsifying agent.
How can Polyglyceryl oleate be used in the context of lubrication?
Polyglyceryl oleate can be used as a lubricant due to its specific properties that aid in reducing friction between surfaces.
PAGE TOP