What is the product name of CAS number 26468-86-0?
The product name is Polyethylene glycol mono(2-ethylhexyl) ether.
What are the synonyms for Polyethylene glycol mono(2-ethylhexyl) ether?
The synonyms are 2-Ethylhexanol, ethoxylated; PEG ethylhexyl ether; Polyoxyethylene mono(2-ethylhexyl) ether; Ethylhexeth.
What is the IUPAC name of Polyethylene glycol mono(2-ethylhexyl) ether?
The IUPAC name is 2-(2-Ethylhexoxy)ethanol.
What is the molecular formula of Polyethylene glycol mono(2-ethylhexyl) ether?
The molecular formula is (C2H4O)n.C8H18O.
What is the SMILES notation for Polyethylene glycol mono(2-ethylhexyl) ether?
The SMILES notation is CCCCC(CC)COCCO.
What is the InChI key for Polyethylene glycol mono(2-ethylhexyl) ether?
The InChI key is InChI=1S/C10H22O2/c1-3-5-6-10(4-2)9-12-8-7-11/h10-11H,3-9H2,1-2H3.
What is the percentage of actives in Polyethylene glycol mono(2-ethylhexyl) ether?
The percentage of actives is 95%.
What is the physical state of Polyethylene glycol mono(2-ethylhexyl) ether?
The physical state can be a solid, paste, or liquid.
What are the typical applications of Polyethylene glycol mono(2-ethylhexyl) ether?
One typical application is as a solubilizing agent.
What is the significance of 2-Ethylhexyl in the name Polyethylene glycol mono(2-ethylhexyl) ether?
2-Ethylhexyl refers to the specific chemical group attached to the polyethylene glycol molecule.