What is the chemical name for Polydextrose?
The chemical name for Polydextrose is (2S,3R,4S,5S,6R)-6-[[(3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
What is the molecular formula of Polydextrose?
The molecular formula of Polydextrose is C12H22O11.
What is the molecular weight of Polydextrose?
The molecular weight of Polydextrose is 342.3.
What are some synonyms for Polydextrose?
Some synonyms for Polydextrose are Poly-D-glucose.
What is the purity of Polydextrose?
The purity of Polydextrose is 95%+.
What is the physical state of Polydextrose?
The physical state of Polydextrose is solid.
What is the typical application of Polydextrose?
The typical applications of Polydextrose are as a thickening agent and stabilizer.
What is the melting point of Polydextrose?
The melting point of Polydextrose is >130 °C.
What is the InChI key of Polydextrose?
The InChI key of Polydextrose is DLRVVLDZNNYCBX-KNHCDGMMSA-N.
What is the SMILES notation for Polydextrose?
The SMILES notation for Polydextrose is C([C@@H]1[C@H]([C@@H]([C@H](C(O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O)O)O)O)O)O)O)O.
PAGE TOP