What is the product name of the chemical compound with CAS number 37205-87-1?
The product name is Poly(oxy-1,2-ethanediyl), alpha-(isononylphenyl)-omega-hydroxy.
What are some synonyms for the compound with CAS number 37205-87-1?
Some synonyms include Ethoxylated isononylphenol, PEG isononyl phenyl ether, and Nonoxynol.
What is the IUPAC name of the compound with CAS number 37205-87-1?
The IUPAC name is 1-Ethoxy-4-(7-methyloctyl)benzene.
What is the molecular formula of the compound with CAS number 37205-87-1?
The molecular formula is (C2H4O)n.C15H24O.
What is the SMILES notation for the compound with CAS number 37205-87-1?
The SMILES notation is CCOC1=CC=C(C=C1)CCCCCCC(C)C.
What is the InChI key for the compound with CAS number 37205-87-1?
The InChI key is InChI=1S/C17H28O/c1-4-18-17-13-11-16(12-14-17)10-8-6-5-7-9-15(2)3/h11-15H,4-10H2,1-3H3.
What is the percentage of actives in the compound with CAS number 37205-87-1?
The percentage of actives is 95%.
In what physical states can the compound with CAS number 37205-87-1 be found?
It can be found in liquid, paste, or solid physical states.
What are some typical applications of the compound with CAS number 37205-87-1?
Some typical applications include being used as a cleansing agent and a leveling agent in textile dye.
How can the compound with CAS number 37205-87-1 be described based on its structure and properties?
The compound can be described as a Poly(oxy-1,2-ethanediyl) with an alpha-(isononylphenyl)-omega-hydroxy structure.