What is the CAS number for Piperlonguminine?
The CAS number for Piperlonguminine is 5950-12-9.
What are some synonyms for Piperlonguminine?
Some synonyms for Piperlonguminine are 5-Benzo[1,3]dioxol-5-yl-N-(2-methylpropyl)penta-2,4-dienamide.
What is the molecular weight of Piperlonguminine?
The molecular weight of Piperlonguminine is 273.33.
What is the molecular formula of Piperlonguminine?
The molecular formula of Piperlonguminine is C16H19NO3.
What is the InChI code for Piperlonguminine?
The InChI code for Piperlonguminine is InChI=1S/C16H19NO3/c1-12(2)10-17-16(18)6-4-3-5-13-7-8-14-15(9-13)20-11-19-14/h3-9,12H,10-11H2,1-2H3,(H,17,18)/b5-3+,6-4+.
What is the InChI Key for Piperlonguminine?
The InChI Key for Piperlonguminine is WHAAPCGHVWVUEX-GGWOSOGESA-N.
What is the purity of Piperlonguminine?
The purity of Piperlonguminine is 95%+.
What percentage of actives does Piperlonguminine contain?
Piperlonguminine contains 95% actives.
What is the physical state of Piperlonguminine?
The physical state of Piperlonguminine is a powder.
What are some typical applications of Piperlonguminine?
Piperlonguminine can be used as an antimicrobial agent and preservative.
PAGE TOP