What is the CAS number for Phenolphthalein?
The CAS number for Phenolphthalein is 77-09-8.
What are some synonyms for Phenolphthalein?
Some synonyms for Phenolphthalein are 3,3-Bis(4-Hydroxyphenyl)-1(3H)-Isobenzofuranone.
What is the molecular weight of Phenolphthalein?
The molecular weight of Phenolphthalein is 318.32.
What is the molecular formula of Phenolphthalein?
The molecular formula of Phenolphthalein is C20H14O4.
What is the boiling point of Phenolphthalein?
The predicted boiling point of Phenolphthalein is 557.8 °C at 760 mmHg.
What is the physical state of Phenolphthalein?
Phenolphthalein is in a solid physical state.
What is the appearance of Phenolphthalein?
The appearance of Phenolphthalein is powder.
What is the percentage of actives in Phenolphthalein?
Phenolphthalein contains 95% actives.
What are some typical applications of Phenolphthalein?
Phenolphthalein is used as an acid-base indicator, as well as a dispersing agent and emulsifying agent.
How can Phenolphthalein be represented in SMILES notation?
Phenolphthalein can be represented in SMILES notation as C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O.
PAGE TOP