What is the CAS number of Pentaerythrityl Tetraisononanoate?
The CAS number of Pentaerythrityl Tetraisononanoate is 93803-89-5.
What is the molecular weight of Pentaerythrityl Tetraisononanoate?
The molecular weight of Pentaerythrityl Tetraisononanoate is 697.04.
What is the molecular formula of Pentaerythrityl Tetraisononanoate?
The molecular formula of Pentaerythrityl Tetraisononanoate is C41H76O8.
What are the synonyms of Pentaerythrityl Tetraisononanoate?
The synonyms of Pentaerythrityl Tetraisononanoate are 2,2-Bis(((1-oxoisononyl)oxy)methyl)-1,3-propanediyl diisononanoate and IUPAC Name [3-(7-Methyloctanoyloxy)-2,2-bis(7-methyloctanoyloxymethyl)propyl] 7-methyloctanoate.
What is the SMILES notation for Pentaerythrityl Tetraisononanoate?
The SMILES notation for Pentaerythrityl Tetraisononanoate is CC(C)CCCCCC(=O)OCC(COC(=O)CCCCCC(C)C)(COC(=O)CCCCCC(C)C)COC(=O)CCCCCC(C)C.
What is the InChI key for Pentaerythrityl Tetraisononanoate?
The InChI key for Pentaerythrityl Tetraisononanoate is PPKAGMLCLQWXJX-UHFFFAOYSA-N.
What is the percentage of actives in Pentaerythrityl Tetraisononanoate?
The percentage of actives in Pentaerythrityl Tetraisononanoate is 95%.
What is the physical state of Pentaerythrityl Tetraisononanoate?
The physical state of Pentaerythrityl Tetraisononanoate is liquid.
What are the typical applications of Pentaerythrityl Tetraisononanoate?
The typical application of Pentaerythrityl Tetraisononanoate is as an emollient.
How many carbons and hydrogens are present in the molecular formula of Pentaerythrityl Tetraisononanoate?
The molecular formula C41H76O8 indicates that Pentaerythrityl Tetraisononanoate contains 41 carbons and 76 hydrogens.
PAGE TOP