
What is the IUPAC name of Panthenyl ethyl ether?
The IUPAC name of Panthenyl ethyl ether is (2R)-N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide.
What is the molecular formula of Panthenyl ethyl ether?
The molecular formula of Panthenyl ethyl ether is C11H23NO4.
What is the CAS number of Panthenyl ethyl ether?
The CAS number of Panthenyl ethyl ether is 667-83-4.
What is the molecular weight of Panthenyl ethyl ether?
The molecular weight of Panthenyl ethyl ether is 233.3.
What is the boiling point of Panthenyl ethyl ether?
The boiling point of Panthenyl ethyl ether is 443.5±45.0 °C.
What is the flash point of Panthenyl ethyl ether?
The flash point of Panthenyl ethyl ether is 110 °C.
What is the density of Panthenyl ethyl ether?
The density of Panthenyl ethyl ether is 1.073g/ml.
What are some typical applications of Panthenyl ethyl ether?
Some typical applications of Panthenyl ethyl ether include use as a dispersing agent, emulsifying agent, and lubricant.
What is the percentage of actives in Panthenyl ethyl ether?
Panthenyl ethyl ether contains 95% actives.
What is the SMILES representation of Panthenyl ethyl ether?
The SMILES representation of Panthenyl ethyl ether is CCOCCCNC(=O)[C@@H](C(C)(C)CO)O.