What is the product name of Palmitamide DEA?
The product name of Palmitamide DEA is Palmitamide DEA.
What is the CAS number of Palmitamide DEA?
The CAS number of Palmitamide DEA is 7545-24-6.
What are some synonyms for Palmitamide DEA?
Some synonyms for Palmitamide DEA are Hexadecanamide, N,N-bis(2-hydroxyethyl)-; N,N-Bis(2-hydroxyethyl)hexadecanamide; Palmitic acid diethanolamide.
What is the IUPAC name of Palmitamide DEA?
The IUPAC name of Palmitamide DEA is N,N-bis(2-hydroxyethyl)hexadecanamide.
What is the molecular weight of Palmitamide DEA?
The molecular weight of Palmitamide DEA is 343.54.
What is the molecular formula of Palmitamide DEA?
The molecular formula of Palmitamide DEA is C20H41NO3.
What is the physical state of Palmitamide DEA?
The physical state of Palmitamide DEA is solid.
What are some typical applications of Palmitamide DEA?
Some typical applications of Palmitamide DEA are as a cleansing agent, emulsifying agent, dispersing agent, and solubilizing agent.
What is the percentage of actives in Palmitamide DEA?
The percentage of actives in Palmitamide DEA is 95%.
Can you provide the SMILES and InChI Key of Palmitamide DEA?
The SMILES of Palmitamide DEA is CCCCCCCCCCCCCCCC(=O)N(CCO)CCO and the InChI Key is InChI=1S/C20H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(24)21(16-18-22)17-19-23/h22-23H,2-19H2,1H3.
PAGE TOP